C14H15F2N3O4 — CID 9352689
N-cyclopropyl-N'-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]oxamide (PubChem CID 9352689) has the molecular formula C14H15F2N3O4 and a molecular weight of 327.29 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 9352689 |
| Molecular Formula | C14H15F2N3O4 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(/C=N\NC(=O)C(=O)NC2CC2)cc1OC(F)F |
| InChI | InChI=1S/C14H15F2N3O4/c1-22-10-5-2-8(6-11(10)23-14(15)16)7-17-19-13(21)12(20)18-9-3-4-9/h2,5-7,9,14H,3-4H2,1H3,(H,18,20)(H,19,21)/b17-7- |
| InChIKey | JTTRKZAQKDQMAK-IDUWFGFVSA-N |
| XLogP | 1.03 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|