C21H26F2N2O3 — CID 9122728
2-(1-adamantyl)-N-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]acetamide (PubChem CID 9122728) has the molecular formula C21H26F2N2O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9122728 |
| Molecular Formula | C21H26F2N2O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-(1-adamantyl)-N-[(Z)-[3-(difluoromethoxy)-4-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CC23CC4CC(CC(C4)C2)C3)cc1OC(F)F |
| InChI | InChI=1S/C21H26F2N2O3/c1-27-17-3-2-13(7-18(17)28-20(22)23)12-24-25-19(26)11-21-8-14-4-15(9-21)6-16(5-14)10-21/h2-3,7,12,14-16,20H,4-6,8-11H2,1H3,(H,25,26)/b24-12- |
| InChIKey | ZOPZSHCHJAAXRA-MSXFZWOLSA-N |
| XLogP | 4.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|