C19H20F2N2O6 — CID 7665174
2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 7665174) has the molecular formula C19H20F2N2O6 and a molecular weight of 410.37 g/mol. Its IUPAC name is 2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7665174 |
| Molecular Formula | C19H20F2N2O6 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CO/N=C\c2ccc(OC(F)F)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H20F2N2O6/c1-25-14-7-5-13(9-17(14)27-3)23-18(24)11-28-22-10-12-4-6-15(29-19(20)21)16(8-12)26-2/h4-10,19H,11H2,1-3H3,(H,23,24)/b22-10- |
| InChIKey | CBNLSONSTYHKJB-YVNNLAQVSA-N |
| XLogP | 3.30 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|