C17H13Cl3F2N2O4 — CID 42967731
2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 42967731) has the molecular formula C17H13Cl3F2N2O4 and a molecular weight of 453.66 g/mol. Its IUPAC name is 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 42967731 |
| Molecular Formula | C17H13Cl3F2N2O4 |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | COc1cc(/C=N/OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C17H13Cl3F2N2O4/c1-26-14-4-9(2-3-13(14)28-17(21)22)7-23-27-8-15(25)24-16-11(19)5-10(18)6-12(16)20/h2-7,17H,8H2,1H3,(H,24,25)/b23-7+ |
| InChIKey | ZOXUGJQMINZBDE-HCGXMYGOSA-N |
| XLogP | 5.25 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|