C23H28F2N2O4 — CID 18276134
2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 18276134) has the molecular formula C23H28F2N2O4 and a molecular weight of 434.48 g/mol. Its IUPAC name is 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 18276134 |
| Molecular Formula | C23H28F2N2O4 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | COc1cc(/C=N/OCC(=O)Nc2c(C(C)C)cccc2C(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C23H28F2N2O4/c1-14(2)17-7-6-8-18(15(3)4)22(17)27-21(28)13-30-26-12-16-9-10-19(31-23(24)25)20(11-16)29-5/h6-12,14-15,23H,13H2,1-5H3,(H,27,28)/b26-12+ |
| InChIKey | DMSONGYEYRWXCD-RPPGKUMJSA-N |
| XLogP | 5.53 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|