C22H28N2O2 — CID 7705493
N-[2,6-di(propan-2-yl)phenyl]-2-[(Z)-(4-methylphenyl)methylideneamino]oxyacetamide (PubChem CID 7705493) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(Z)-(4-methylphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(Z)-(4-methylphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7705493 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(Z)-(4-methylphenyl)methylideneamino]oxyacetamide |
| SMILES | Cc1ccc(/C=N\OCC(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-15(2)19-7-6-8-20(16(3)4)22(19)24-21(25)14-26-23-13-18-11-9-17(5)10-12-18/h6-13,15-16H,14H2,1-5H3,(H,24,25)/b23-13- |
| InChIKey | MOZCZKPNTSNMCT-QRVIBDJDSA-N |
| XLogP | 5.23 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|