C19H19ClF2N2O4 — CID 24606445
N-(2-chloro-4,6-dimethylphenyl)-2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide (PubChem CID 24606445) has the molecular formula C19H19ClF2N2O4 and a molecular weight of 412.82 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 24606445 |
| Molecular Formula | C19H19ClF2N2O4 |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide |
| SMILES | COc1cc(/C=N/OCC(=O)Nc2c(C)cc(C)cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C19H19ClF2N2O4/c1-11-6-12(2)18(14(20)7-11)24-17(25)10-27-23-9-13-4-5-15(28-19(21)22)16(8-13)26-3/h4-9,19H,10H2,1-3H3,(H,24,25)/b23-9+ |
| InChIKey | MZRKNCVQYUWJRG-NUGSKGIGSA-N |
| XLogP | 4.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|