C17H14ClF3N2O4 — CID 7665154
N-(4-chloro-2-fluorophenyl)-2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide (PubChem CID 7665154) has the molecular formula C17H14ClF3N2O4 and a molecular weight of 402.76 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7665154 |
| Molecular Formula | C17H14ClF3N2O4 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxyacetamide |
| SMILES | COc1cc(/C=N\OCC(=O)Nc2ccc(Cl)cc2F)ccc1OC(F)F |
| InChI | InChI=1S/C17H14ClF3N2O4/c1-25-15-6-10(2-5-14(15)27-17(20)21)8-22-26-9-16(24)23-13-4-3-11(18)7-12(13)19/h2-8,17H,9H2,1H3,(H,23,24)/b22-8- |
| InChIKey | JMAPQBAWZAJDCR-UYOCIXKTSA-N |
| XLogP | 4.08 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|