C17H17BrN2O4 — CID 7668804
N-(4-bromophenyl)-2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxyacetamide (PubChem CID 7668804) has the molecular formula C17H17BrN2O4 and a molecular weight of 393.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-(4-bromophenyl)-2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7668804 |
| Molecular Formula | C17H17BrN2O4 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxyacetamide |
| SMILES | COc1ccc(/C=N\OCC(=O)Nc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C17H17BrN2O4/c1-22-15-8-3-12(9-16(15)23-2)10-19-24-11-17(21)20-14-6-4-13(18)5-7-14/h3-10H,11H2,1-2H3,(H,20,21)/b19-10- |
| InChIKey | QFHDTWMCCWNNMM-GRSHGNNSSA-N |
| XLogP | 3.46 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|