C21H24N2O6 — CID 7700304
methyl 4-[[2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetyl]amino]benzoate (PubChem CID 7700304) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is methyl 4-[[2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7700304 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl 4-[[2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CO/N=C\c2ccc(OC(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H24N2O6/c1-14(2)29-18-10-5-15(11-19(18)26-3)12-22-28-13-20(24)23-17-8-6-16(7-9-17)21(25)27-4/h5-12,14H,13H2,1-4H3,(H,23,24)/b22-12- |
| InChIKey | WYALJCQORABLOY-UUYOSTAYSA-N |
| XLogP | 3.26 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|