C20H21N3O4 — CID 7700326
N-(4-cyanophenyl)-2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetamide (PubChem CID 7700326) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-(4-cyanophenyl)-2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7700326 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(4-cyanophenyl)-2-[(Z)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]oxyacetamide |
| SMILES | COc1cc(/C=N\OCC(=O)Nc2ccc(C#N)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C20H21N3O4/c1-14(2)27-18-9-6-16(10-19(18)25-3)12-22-26-13-20(24)23-17-7-4-15(11-21)5-8-17/h4-10,12,14H,13H2,1-3H3,(H,23,24)/b22-12- |
| InChIKey | XICFBTSJSYDKTA-UUYOSTAYSA-N |
| XLogP | 3.34 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|