C22H28N2O4 — CID 7662805
N-(4-tert-butylphenyl)-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide (PubChem CID 7662805) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7662805 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide |
| SMILES | CCOc1ccc(/C=N\OCC(=O)Nc2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H28N2O4/c1-6-27-19-12-7-16(13-20(19)26-5)14-23-28-15-21(25)24-18-10-8-17(9-11-18)22(2,3)4/h7-14H,6,15H2,1-5H3,(H,24,25)/b23-14- |
| InChIKey | LSNWAGRXZAGNPO-UCQKPKSFSA-N |
| XLogP | 4.38 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|