C13H14N4O6 — CID 135813870
N-cyclopropyl-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]oxamide (PubChem CID 135813870) has the molecular formula C13H14N4O6 and a molecular weight of 322.28 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135813870 |
| Molecular Formula | C13H14N4O6 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC2CC2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H14N4O6/c1-23-10-5-7(4-9(11(10)18)17(21)22)6-14-16-13(20)12(19)15-8-2-3-8/h4-6,8,18H,2-3H2,1H3,(H,15,19)(H,16,20)/b14-6- |
| InChIKey | CFLIFHKHQAMVKW-NSIKDUERSA-N |
| XLogP | 0.04 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|