C13H16N4O6 — CID 135813833
N'-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-propan-2-yloxamide (PubChem CID 135813833) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is N'-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 135813833 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N'-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-propan-2-yloxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)NC(C)C)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H16N4O6/c1-7(2)15-12(19)13(20)16-14-6-8-4-9(17(21)22)11(18)10(5-8)23-3/h4-7,18H,1-3H3,(H,15,19)(H,16,20)/b14-6+ |
| InChIKey | DXPFVPKTPXIVRB-MKMNVTDBSA-N |
| XLogP | 0.28 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|