C18H18N4O6 — CID 135813872
N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide (PubChem CID 135813872) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 135813872 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccc(C)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H18N4O6/c1-11-3-5-12(6-4-11)9-19-17(24)18(25)21-20-10-13-7-14(22(26)27)16(23)15(8-13)28-2/h3-8,10,23H,9H2,1-2H3,(H,19,24)(H,21,25)/b20-10- |
| InChIKey | DWJSRIKFHXBXQU-JMIUGGIZSA-N |
| XLogP | 1.38 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|