C16H15N5O5 — CID 94833483
N'-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 94833483) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is N'-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 94833483 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N'-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | COc1ccc(/C=N\NC(=O)C(=O)NCc2ccncc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N5O5/c1-26-14-3-2-12(8-13(14)21(24)25)10-19-20-16(23)15(22)18-9-11-4-6-17-7-5-11/h2-8,10H,9H2,1H3,(H,18,22)(H,20,23)/b19-10- |
| InChIKey | JYHJLMRGFBIISC-GRSHGNNSSA-N |
| XLogP | 0.76 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|