C14H11BrN4O4 — CID 3359702
5-bromo-N-[(4-methoxy-3-nitrophenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 3359702) has the molecular formula C14H11BrN4O4 and a molecular weight of 379.17 g/mol. Its IUPAC name is 5-bromo-N-[(4-methoxy-3-nitrophenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(4-methoxy-3-nitrophenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3359702 |
| Molecular Formula | C14H11BrN4O4 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 5-bromo-N-[(4-methoxy-3-nitrophenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2cncc(Br)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11BrN4O4/c1-23-13-3-2-9(4-12(13)19(21)22)6-17-18-14(20)10-5-11(15)8-16-7-10/h2-8H,1H3,(H,18,20) |
| InChIKey | IVITVMJDIDFANE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|