C16H13BrN4O6 — CID 4570521
[4-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxy-3-nitrophenyl] acetate (PubChem CID 4570521) has the molecular formula C16H13BrN4O6 and a molecular weight of 437.21 g/mol. Its IUPAC name is [4-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxy-3-nitrophenyl] acetate.
| Compound Name | [4-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxy-3-nitrophenyl] acetate |
|---|---|
| PubChem CID | 4570521 |
| Molecular Formula | C16H13BrN4O6 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | [4-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxy-3-nitrophenyl] acetate |
| SMILES | COc1c(OC(C)=O)ccc(C=NNC(=O)c2cncc(Br)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13BrN4O6/c1-9(22)27-13-4-3-10(14(21(24)25)15(13)26-2)7-19-20-16(23)11-5-12(17)8-18-6-11/h3-8H,1-2H3,(H,20,23) |
| InChIKey | OLXUPYRNGVIBBS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|