C20H12Br2N4O5 — CID 5113934
[2-bromo-6-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate (PubChem CID 5113934) has the molecular formula C20H12Br2N4O5 and a molecular weight of 548.15 g/mol. Its IUPAC name is [2-bromo-6-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate.
| Compound Name | [2-bromo-6-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
|---|---|
| PubChem CID | 5113934 |
| Molecular Formula | C20H12Br2N4O5 |
| Molecular Weight | 548.15 g/mol |
| Exact Mass | 545.92 |
| IUPAC Name | [2-bromo-6-[[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])cc(Br)c1OC(=O)c1ccccc1)c1cncc(Br)c1 |
| InChI | InChI=1S/C20H12Br2N4O5/c21-15-6-14(9-23-11-15)19(27)25-24-10-13-7-16(26(29)30)8-17(22)18(13)31-20(28)12-4-2-1-3-5-12/h1-11H,(H,25,27) |
| InChIKey | ZIFVCCJUIVFGTB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|