C30H20Br2N4O5 — CID 126399034
[2,4-dibromo-6-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126399034) has the molecular formula C30H20Br2N4O5 and a molecular weight of 676.32 g/mol. Its IUPAC name is [2,4-dibromo-6-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2,4-dibromo-6-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126399034 |
| Molecular Formula | C30H20Br2N4O5 |
| Molecular Weight | 676.32 g/mol |
| Exact Mass | 673.98 |
| IUPAC Name | [2,4-dibromo-6-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | Cc1cccc2c(-c3ccccc3)c(C(=O)NN=Cc3cc(Br)cc(Br)c3OC(=O)c3ccc([N+](=O)[O-])cc3)[nH]c12 |
| InChI | InChI=1S/C30H20Br2N4O5/c1-17-6-5-9-23-25(18-7-3-2-4-8-18)27(34-26(17)23)29(37)35-33-16-20-14-21(31)15-24(32)28(20)41-30(38)19-10-12-22(13-11-19)36(39)40/h2-16,34H,1H3,(H,35,37) |
| InChIKey | BCLLFFUEGDUIFA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.32 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|