C31H22Br3N3O3 — CID 126400686
[2,4-dibromo-6-[[(7-ethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 126400686) has the molecular formula C31H22Br3N3O3 and a molecular weight of 724.25 g/mol. Its IUPAC name is [2,4-dibromo-6-[[(7-ethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2,4-dibromo-6-[[(7-ethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126400686 |
| Molecular Formula | C31H22Br3N3O3 |
| Molecular Weight | 724.25 g/mol |
| Exact Mass | 720.92 |
| IUPAC Name | [2,4-dibromo-6-[[(7-ethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | CCc1cccc2c(-c3ccccc3)c(C(=O)NN=Cc3cc(Br)cc(Br)c3OC(=O)c3ccc(Br)cc3)[nH]c12 |
| InChI | InChI=1S/C31H22Br3N3O3/c1-2-18-9-6-10-24-26(19-7-4-3-5-8-19)28(36-27(18)24)30(38)37-35-17-21-15-23(33)16-25(34)29(21)40-31(39)20-11-13-22(32)14-12-20/h3-17,36H,2H2,1H3,(H,37,38) |
| InChIKey | WSBJWUJXRBJDJK-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.25 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|