C29H18Br2ClN3O3 — CID 126400988
[2,4-dibromo-6-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 126400988) has the molecular formula C29H18Br2ClN3O3 and a molecular weight of 651.74 g/mol. Its IUPAC name is [2,4-dibromo-6-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2,4-dibromo-6-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126400988 |
| Molecular Formula | C29H18Br2ClN3O3 |
| Molecular Weight | 651.74 g/mol |
| Exact Mass | 648.94 |
| IUPAC Name | [2,4-dibromo-6-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C=NNC(=O)c1[nH]c2ccccc2c1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H18Br2ClN3O3/c30-20-14-19(27(23(31)15-20)38-29(37)18-10-12-21(32)13-11-18)16-33-35-28(36)26-25(17-6-2-1-3-7-17)22-8-4-5-9-24(22)34-26/h1-16,34H,(H,35,36) |
| InChIKey | YKBVHEFPBNIDQL-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.74 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|