C32H22Br2FN3O6 — CID 126400630
[2,4-dibromo-6-[[(7-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126400630) has the molecular formula C32H22Br2FN3O6 and a molecular weight of 723.35 g/mol. Its IUPAC name is [2,4-dibromo-6-[[(7-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [2,4-dibromo-6-[[(7-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126400630 |
| Molecular Formula | C32H22Br2FN3O6 |
| Molecular Weight | 723.35 g/mol |
| Exact Mass | 720.99 |
| IUPAC Name | [2,4-dibromo-6-[[(7-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2[nH]c3c(F)cccc3c2-c2ccccc2)ccc1OC(C)=O |
| InChI | InChI=1S/C32H22Br2FN3O6/c1-17(39)43-25-12-11-19(14-26(25)42-2)32(41)44-30-20(13-21(33)15-23(30)34)16-36-38-31(40)29-27(18-7-4-3-5-8-18)22-9-6-10-24(35)28(22)37-29/h3-16,37H,1-2H3,(H,38,40) |
| InChIKey | WFSVAMLOWJNWRJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.35 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|