C33H24F3N3O6 — CID 126402223
[2-[[[3-phenyl-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126402223) has the molecular formula C33H24F3N3O6 and a molecular weight of 615.56 g/mol. Its IUPAC name is [2-[[[3-phenyl-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [2-[[[3-phenyl-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126402223 |
| Molecular Formula | C33H24F3N3O6 |
| Molecular Weight | 615.56 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | [2-[[[3-phenyl-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2C=NNC(=O)c2[nH]c3c(C(F)(F)F)cccc3c2-c2ccccc2)ccc1OC(C)=O |
| InChI | InChI=1S/C33H24F3N3O6/c1-19(40)44-26-16-15-21(17-27(26)43-2)32(42)45-25-14-7-6-11-22(25)18-37-39-31(41)30-28(20-9-4-3-5-10-20)23-12-8-13-24(29(23)38-30)33(34,35)36/h3-18,38H,1-2H3,(H,39,41) |
| InChIKey | MRMIFPQNTPKUGN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|