C33H26BrN3O6 — CID 126399246
[4-bromo-2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126399246) has the molecular formula C33H26BrN3O6 and a molecular weight of 640.49 g/mol. Its IUPAC name is [4-bromo-2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [4-bromo-2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126399246 |
| Molecular Formula | C33H26BrN3O6 |
| Molecular Weight | 640.49 g/mol |
| Exact Mass | 639.10 |
| IUPAC Name | [4-bromo-2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3ccc(C)cc3c2-c2ccccc2)ccc1OC(C)=O |
| InChI | InChI=1S/C33H26BrN3O6/c1-19-9-12-26-25(15-19)30(21-7-5-4-6-8-21)31(36-26)32(39)37-35-18-23-16-24(34)11-14-27(23)43-33(40)22-10-13-28(42-20(2)38)29(17-22)41-3/h4-18,36H,1-3H3,(H,37,39) |
| InChIKey | DVXMCTCAECTTCR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.49 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|