C31H25N3O3 — CID 126401641
[2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 126401641) has the molecular formula C31H25N3O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is [2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126401641 |
| Molecular Formula | C31H25N3O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccccc2C=NNC(=O)c2[nH]c3ccc(C)cc3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C31H25N3O3/c1-20-9-8-13-23(17-20)31(36)37-27-14-7-6-12-24(27)19-32-34-30(35)29-28(22-10-4-3-5-11-22)25-18-21(2)15-16-26(25)33-29/h3-19,33H,1-2H3,(H,34,35) |
| InChIKey | GCKPMUSLAKSXRZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|