C32H24BrN3O6 — CID 126401904
[2-[[(7-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126401904) has the molecular formula C32H24BrN3O6 and a molecular weight of 626.46 g/mol. Its IUPAC name is [2-[[(7-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [2-[[(7-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126401904 |
| Molecular Formula | C32H24BrN3O6 |
| Molecular Weight | 626.46 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | [2-[[(7-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2C=NNC(=O)c2[nH]c3c(Br)cccc3c2-c2ccccc2)ccc1OC(C)=O |
| InChI | InChI=1S/C32H24BrN3O6/c1-19(37)41-26-16-15-21(17-27(26)40-2)32(39)42-25-14-7-6-11-22(25)18-34-36-31(38)30-28(20-9-4-3-5-10-20)23-12-8-13-24(33)29(23)35-30/h3-18,35H,1-2H3,(H,36,38) |
| InChIKey | IZPYHXIZUSMOFF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|