C31H19F3N4O3 — CID 126401260
[2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 126401260) has the molecular formula C31H19F3N4O3 and a molecular weight of 552.51 g/mol. Its IUPAC name is [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126401260 |
| Molecular Formula | C31H19F3N4O3 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | N#Cc1cccc2c(-c3ccccc3)c(C(=O)NN=Cc3ccccc3OC(=O)c3cccc(C(F)(F)F)c3)[nH]c12 |
| InChI | InChI=1S/C31H19F3N4O3/c32-31(33,34)23-13-6-11-20(16-23)30(40)41-25-15-5-4-10-22(25)18-36-38-29(39)28-26(19-8-2-1-3-9-19)24-14-7-12-21(17-35)27(24)37-28/h1-16,18,37H,(H,38,39) |
| InChIKey | AJXXCMHSXWJDIC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|