C31H21BrN4O4 — CID 126400756
[4-bromo-2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methoxybenzoate (PubChem CID 126400756) has the molecular formula C31H21BrN4O4 and a molecular weight of 593.44 g/mol. Its IUPAC name is [4-bromo-2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-bromo-2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 126400756 |
| Molecular Formula | C31H21BrN4O4 |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | [4-bromo-2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3c(C#N)cccc3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C31H21BrN4O4/c1-39-24-11-5-9-20(16-24)31(38)40-26-14-13-23(32)15-22(26)18-34-36-30(37)29-27(19-7-3-2-4-8-19)25-12-6-10-21(17-33)28(25)35-29/h2-16,18,35H,1H3,(H,36,37) |
| InChIKey | XCOVJHHIIZKOTC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|