C31H20BrClN4O3 — CID 126399262
[4-bromo-2-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126399262) has the molecular formula C31H20BrClN4O3 and a molecular weight of 611.88 g/mol. Its IUPAC name is [4-bromo-2-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-bromo-2-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126399262 |
| Molecular Formula | C31H20BrClN4O3 |
| Molecular Weight | 611.88 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | [4-bromo-2-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3c(C#N)cccc3c2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C31H20BrClN4O3/c1-18-9-11-19(12-10-18)31(39)40-26-14-13-22(32)15-21(26)17-35-37-30(38)29-27(23-6-2-3-8-25(23)33)24-7-4-5-20(16-34)28(24)36-29/h2-15,17,36H,1H3,(H,37,38) |
| InChIKey | FBQKCJRZBSEKSH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.88 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|