C29H17Br2ClN4O5 — CID 126400101
[4-bromo-2-[[[7-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126400101) has the molecular formula C29H17Br2ClN4O5 and a molecular weight of 696.74 g/mol. Its IUPAC name is [4-bromo-2-[[[7-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-bromo-2-[[[7-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126400101 |
| Molecular Formula | C29H17Br2ClN4O5 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 693.93 |
| IUPAC Name | [4-bromo-2-[[[7-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc(Br)cc1C=NNC(=O)c1[nH]c2c(Br)cccc2c1-c1ccccc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H17Br2ClN4O5/c30-18-10-13-24(41-29(38)16-8-11-19(12-9-16)36(39)40)17(14-18)15-33-35-28(37)27-25(20-4-1-2-7-23(20)32)21-5-3-6-22(31)26(21)34-27/h1-15,34H,(H,35,37) |
| InChIKey | PAJFWLZCNVRYGK-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|