C29H16Br2ClIN4O5 — CID 126400013
[2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126400013) has the molecular formula C29H16Br2ClIN4O5 and a molecular weight of 822.63 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126400013 |
| Molecular Formula | C29H16Br2ClIN4O5 |
| Molecular Weight | 822.63 g/mol |
| Exact Mass | 819.82 |
| IUPAC Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C=NNC(=O)c1[nH]c2ccc(I)cc2c1-c1ccccc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H16Br2ClIN4O5/c30-17-11-16(27(22(31)12-17)42-29(39)15-5-8-19(9-6-15)37(40)41)14-34-36-28(38)26-25(20-3-1-2-4-23(20)32)21-13-18(33)7-10-24(21)35-26/h1-14,35H,(H,36,38) |
| InChIKey | NYOBSIPROSODPG-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.63 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|