C30H16Br3ClF3N3O3 — CID 126399344
[2,4-dibromo-6-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 126399344) has the molecular formula C30H16Br3ClF3N3O3 and a molecular weight of 798.63 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2,4-dibromo-6-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126399344 |
| Molecular Formula | C30H16Br3ClF3N3O3 |
| Molecular Weight | 798.63 g/mol |
| Exact Mass | 794.84 |
| IUPAC Name | [2,4-dibromo-6-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C=NNC(=O)c1[nH]c2ccc(Br)cc2c1-c1ccccc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H16Br3ClF3N3O3/c31-18-8-9-24-21(12-18)25(20-6-1-2-7-23(20)34)26(39-24)28(41)40-38-14-16-11-19(32)13-22(33)27(16)43-29(42)15-4-3-5-17(10-15)30(35,36)37/h1-14,39H,(H,40,41) |
| InChIKey | GBMPFTOUVHVKQH-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.63 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|