C33H25Br2ClFN3O5 — CID 126399275
[2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate (PubChem CID 126399275) has the molecular formula C33H25Br2ClFN3O5 and a molecular weight of 757.84 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate.
| Compound Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 126399275 |
| Molecular Formula | C33H25Br2ClFN3O5 |
| Molecular Weight | 757.84 g/mol |
| Exact Mass | 754.98 |
| IUPAC Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2[nH]c3ccc(F)cc3c2-c2ccccc2Cl)cc1OCC |
| InChI | InChI=1S/C33H25Br2ClFN3O5/c1-3-43-27-12-9-18(14-28(27)44-4-2)33(42)45-31-19(13-20(34)15-24(31)35)17-38-40-32(41)30-29(22-7-5-6-8-25(22)36)23-16-21(37)10-11-26(23)39-30/h5-17,39H,3-4H2,1-2H3,(H,40,41) |
| InChIKey | FFQKCVSRBFEJIY-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.84 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|