C30H20BrClFN3O3 — CID 126399253
[4-bromo-2-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 126399253) has the molecular formula C30H20BrClFN3O3 and a molecular weight of 604.86 g/mol. Its IUPAC name is [4-bromo-2-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126399253 |
| Molecular Formula | C30H20BrClFN3O3 |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 603.04 |
| IUPAC Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3ccc(F)cc3c2-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C30H20BrClFN3O3/c1-17-5-4-6-18(13-17)30(38)39-26-12-9-20(31)14-19(26)16-34-36-29(37)28-27(22-7-2-3-8-24(22)32)23-15-21(33)10-11-25(23)35-28/h2-16,35H,1H3,(H,36,37) |
| InChIKey | DZBWXZMJLXWVTJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|