C31H24BrClN4O3 — CID 126399464
[4-bromo-2-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126399464) has the molecular formula C31H24BrClN4O3 and a molecular weight of 615.92 g/mol. Its IUPAC name is [4-bromo-2-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126399464 |
| Molecular Formula | C31H24BrClN4O3 |
| Molecular Weight | 615.92 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | CN(C)c1ccc2[nH]c(C(=O)NN=Cc3cc(Br)ccc3OC(=O)c3ccccc3)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C31H24BrClN4O3/c1-37(2)22-13-14-26-24(17-22)28(23-10-6-7-11-25(23)33)29(35-26)30(38)36-34-18-20-16-21(32)12-15-27(20)40-31(39)19-8-4-3-5-9-19/h3-18,35H,1-2H3,(H,36,38) |
| InChIKey | HPCRYSRQPDEYGB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.92 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|