C32H25BrClN3O4 — CID 126400236
[4-bromo-2-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126400236) has the molecular formula C32H25BrClN3O4 and a molecular weight of 630.93 g/mol. Its IUPAC name is [4-bromo-2-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126400236 |
| Molecular Formula | C32H25BrClN3O4 |
| Molecular Weight | 630.93 g/mol |
| Exact Mass | 629.07 |
| IUPAC Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | CCOc1ccc2[nH]c(C(=O)NN=Cc3cc(Br)ccc3OC(=O)c3ccc(C)cc3)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C32H25BrClN3O4/c1-3-40-23-13-14-27-25(17-23)29(24-6-4-5-7-26(24)34)30(36-27)31(38)37-35-18-21-16-22(33)12-15-28(21)41-32(39)20-10-8-19(2)9-11-20/h4-18,36H,3H2,1-2H3,(H,37,38) |
| InChIKey | QSYCJDGRPMXYBW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.93 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|