C31H23BrClN3O5 — CID 126400086
[4-bromo-2-[[[3-(2-chlorophenyl)-5-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate (PubChem CID 126400086) has the molecular formula C31H23BrClN3O5 and a molecular weight of 632.90 g/mol. Its IUPAC name is [4-bromo-2-[[[3-(2-chlorophenyl)-5-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 126400086 |
| Molecular Formula | C31H23BrClN3O5 |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 631.05 |
| IUPAC Name | [4-bromo-2-[[[3-(2-chlorophenyl)-5-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3ccc(OC)cc3c2-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C31H23BrClN3O5/c1-39-21-7-5-6-18(15-21)31(38)41-27-13-10-20(32)14-19(27)17-34-36-30(37)29-28(23-8-3-4-9-25(23)33)24-16-22(40-2)11-12-26(24)35-29/h3-17,35H,1-2H3,(H,36,37) |
| InChIKey | OXGAXOGQMBRPDX-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|