C32H24Br2ClN3O5 — CID 126400198
[2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate (PubChem CID 126400198) has the molecular formula C32H24Br2ClN3O5 and a molecular weight of 725.82 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 126400198 |
| Molecular Formula | C32H24Br2ClN3O5 |
| Molecular Weight | 725.82 g/mol |
| Exact Mass | 722.98 |
| IUPAC Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-5-ethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-methoxybenzoate |
| SMILES | CCOc1ccc2[nH]c(C(=O)NN=Cc3cc(Br)cc(Br)c3OC(=O)c3cccc(OC)c3)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C32H24Br2ClN3O5/c1-3-42-22-11-12-27-24(16-22)28(23-9-4-5-10-26(23)35)29(37-27)31(39)38-36-17-19-13-20(33)15-25(34)30(19)43-32(40)18-7-6-8-21(14-18)41-2/h4-17,37H,3H2,1-2H3,(H,38,39) |
| InChIKey | QHGAMIMLSKAGDT-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.82 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|