C31H22BrClFN3O4 — CID 126401513
[4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-bromobenzoate (PubChem CID 126401513) has the molecular formula C31H22BrClFN3O4 and a molecular weight of 634.89 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-bromobenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126401513 |
| Molecular Formula | C31H22BrClFN3O4 |
| Molecular Weight | 634.89 g/mol |
| Exact Mass | 633.05 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-bromobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3ccc(F)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H22BrClFN3O4/c1-2-40-27-15-18(7-14-26(27)41-31(39)19-8-10-20(32)11-9-19)17-35-37-30(38)29-28(22-5-3-4-6-24(22)33)23-16-21(34)12-13-25(23)36-29/h3-17,36H,2H2,1H3,(H,37,38) |
| InChIKey | DLVJDJHOGZCREA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.89 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|