C33H25ClFN3O7 — CID 126402150
[4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126402150) has the molecular formula C33H25ClFN3O7 and a molecular weight of 630.03 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126402150 |
| Molecular Formula | C33H25ClFN3O7 |
| Molecular Weight | 630.03 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C=NNC(=O)c3[nH]c4ccc(F)cc4c3-c3ccccc3Cl)cc2OC)ccc1OC(C)=O |
| InChI | InChI=1S/C33H25ClFN3O7/c1-18(39)44-26-13-9-20(15-29(26)43-3)33(41)45-27-12-8-19(14-28(27)42-2)17-36-38-32(40)31-30(22-6-4-5-7-24(22)34)23-16-21(35)10-11-25(23)37-31/h4-17,37H,1-3H3,(H,38,40) |
| InChIKey | LUQCUNLTSHJKKD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.03 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|