C34H27ClIN3O7 — CID 126400852
[4-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126400852) has the molecular formula C34H27ClIN3O7 and a molecular weight of 751.96 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126400852 |
| Molecular Formula | C34H27ClIN3O7 |
| Molecular Weight | 751.96 g/mol |
| Exact Mass | 751.06 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-5-iodo-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3ccc(I)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C34H27ClIN3O7/c1-4-44-30-15-20(9-13-28(30)46-34(42)21-10-14-27(45-19(2)40)29(16-21)43-3)18-37-39-33(41)32-31(23-7-5-6-8-25(23)35)24-17-22(36)11-12-26(24)38-32/h5-18,38H,4H2,1-3H3,(H,39,41) |
| InChIKey | KVUDOEMCHJHCBU-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|