C35H31N3O8 — CID 126400646
[2-ethoxy-4-[[(5-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126400646) has the molecular formula C35H31N3O8 and a molecular weight of 621.65 g/mol. Its IUPAC name is [2-ethoxy-4-[[(5-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [2-ethoxy-4-[[(5-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126400646 |
| Molecular Formula | C35H31N3O8 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | [2-ethoxy-4-[[(5-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3ccc(OC)cc3c2-c2ccccc2)ccc1OC(=O)c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C35H31N3O8/c1-5-44-31-17-22(11-15-29(31)46-35(41)24-12-16-28(45-21(2)39)30(18-24)43-4)20-36-38-34(40)33-32(23-9-7-6-8-10-23)26-19-25(42-3)13-14-27(26)37-33/h6-20,37H,5H2,1-4H3,(H,38,40) |
| InChIKey | AEZRKHTWQHDPNU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|