C36H33N3O9 — CID 126400784
[4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126400784) has the molecular formula C36H33N3O9 and a molecular weight of 651.67 g/mol. Its IUPAC name is [4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126400784 |
| Molecular Formula | C36H33N3O9 |
| Molecular Weight | 651.67 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | [4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(OC)ccc(OC)c3c2-c2ccccc2)ccc1OC(=O)c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C36H33N3O9/c1-6-46-30-18-22(12-14-26(30)48-36(42)24-13-15-25(47-21(2)40)29(19-24)45-5)20-37-39-35(41)34-31(23-10-8-7-9-11-23)32-27(43-3)16-17-28(44-4)33(32)38-34/h7-20,38H,6H2,1-5H3,(H,39,41) |
| InChIKey | HVYUOSCXNDNBOQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|