C36H35N3O9 — CID 126401900
[4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126401900) has the molecular formula C36H35N3O9 and a molecular weight of 653.69 g/mol. Its IUPAC name is [4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126401900 |
| Molecular Formula | C36H35N3O9 |
| Molecular Weight | 653.69 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | [4-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(OC)ccc(OC)c3c2-c2ccccc2)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C36H35N3O9/c1-7-47-27-17-21(13-14-24(27)48-36(41)23-18-28(44-4)34(46-6)29(19-23)45-5)20-37-39-35(40)33-30(22-11-9-8-10-12-22)31-25(42-2)15-16-26(43-3)32(31)38-33/h8-20,38H,7H2,1-6H3,(H,39,40) |
| InChIKey | IYXQJPRWEOMSPX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|