C33H27Cl2N3O7 — CID 126401598
[4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126401598) has the molecular formula C33H27Cl2N3O7 and a molecular weight of 648.50 g/mol. Its IUPAC name is [4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126401598 |
| Molecular Formula | C33H27Cl2N3O7 |
| Molecular Weight | 648.50 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | [4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(Cl)cc(Cl)cc3c2-c2ccccc2)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C33H27Cl2N3O7/c1-41-25-12-18(10-11-24(25)45-33(40)20-13-26(42-2)31(44-4)27(14-20)43-3)17-36-38-32(39)30-28(19-8-6-5-7-9-19)22-15-21(34)16-23(35)29(22)37-30/h5-17,37H,1-4H3,(H,38,39) |
| InChIKey | FRHCGVIJSIJRMS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.50 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|