C31H22Cl2N4O6 — CID 126402389
[4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate (PubChem CID 126402389) has the molecular formula C31H22Cl2N4O6 and a molecular weight of 617.45 g/mol. Its IUPAC name is [4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126402389 |
| Molecular Formula | C31H22Cl2N4O6 |
| Molecular Weight | 617.45 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | [4-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(Cl)cc(Cl)cc3c2-c2ccccc2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H22Cl2N4O6/c1-2-42-26-14-18(8-13-25(26)43-31(39)20-9-11-22(12-10-20)37(40)41)17-34-36-30(38)29-27(19-6-4-3-5-7-19)23-15-21(32)16-24(33)28(23)35-29/h3-17,35H,2H2,1H3,(H,36,38) |
| InChIKey | OPFYHQLEHWAJNP-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.45 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|