C34H24N4O6 — CID 126401400
[2-methoxy-4-[[(3-phenyl-1H-benzo[g]indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126401400) has the molecular formula C34H24N4O6 and a molecular weight of 584.59 g/mol. Its IUPAC name is [2-methoxy-4-[[(3-phenyl-1H-benzo[g]indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-methoxy-4-[[(3-phenyl-1H-benzo[g]indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126401400 |
| Molecular Formula | C34H24N4O6 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | [2-methoxy-4-[[(3-phenyl-1H-benzo[g]indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(ccc4ccccc43)c2-c2ccccc2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H24N4O6/c1-43-29-19-21(11-18-28(29)44-34(40)24-12-15-25(16-13-24)38(41)42)20-35-37-33(39)32-30(23-8-3-2-4-9-23)27-17-14-22-7-5-6-10-26(22)31(27)36-32/h2-20,36H,1H3,(H,37,39) |
| InChIKey | CAXAPSWPUHYWQW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|