C30H23N3O4 — CID 126401311
[2-methoxy-4-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126401311) has the molecular formula C30H23N3O4 and a molecular weight of 489.53 g/mol. Its IUPAC name is [2-methoxy-4-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126401311 |
| Molecular Formula | C30H23N3O4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [2-methoxy-4-[[(3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3ccccc3c2-c2ccccc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H23N3O4/c1-36-26-18-20(16-17-25(26)37-30(35)22-12-6-3-7-13-22)19-31-33-29(34)28-27(21-10-4-2-5-11-21)23-14-8-9-15-24(23)32-28/h2-19,32H,1H3,(H,33,34) |
| InChIKey | AXXBBDJRMOHOBH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|