C35H33N3O8 — CID 126402183
[4-[[(5-ethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126402183) has the molecular formula C35H33N3O8 and a molecular weight of 623.66 g/mol. Its IUPAC name is [4-[[(5-ethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[[(5-ethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126402183 |
| Molecular Formula | C35H33N3O8 |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | [4-[[(5-ethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOc1ccc2[nH]c(C(=O)NN=Cc3ccc(OC(=O)c4cc(OC)c(OC)c(OC)c4)c(OC)c3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C35H33N3O8/c1-6-45-24-13-14-26-25(19-24)31(22-10-8-7-9-11-22)32(37-26)34(39)38-36-20-21-12-15-27(28(16-21)41-2)46-35(40)23-17-29(42-3)33(44-5)30(18-23)43-4/h7-20,37H,6H2,1-5H3,(H,38,39) |
| InChIKey | MFDMTESJAQSIIV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|